C30H37N3O8S — CID 158673245
(6S,8R,8aS)-7-azido-6-[(3R,4S,6S)-2,5-dimethyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-2,8-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;carbon dioxide (PubChem CID 158673245) has the molecular formula C30H37N3O8S and a molecular weight of 599.71 g/mol. Its IUPAC name is (6S,8R,8aS)-7-azido-6-[(3R,4S,6S)-2,5-dimethyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-2,8-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;carbon dioxide.
| Compound Name | (6S,8R,8aS)-7-azido-6-[(3R,4S,6S)-2,5-dimethyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-2,8-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;carbon dioxide |
|---|---|
| PubChem CID | 158673245 |
| Molecular Formula | C30H37N3O8S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | (6S,8R,8aS)-7-azido-6-[(3R,4S,6S)-2,5-dimethyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxy-2,8-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine;carbon dioxide |
| SMILES | CC1OCC2O[C@@H](O[C@@H]3C(C)O[C@@H](Sc4ccccc4)C(C)[C@@H]3OCc3ccccc3)C(N=[N+]=[N-])[C@@H](C)[C@@H]2O1.O=C=O |
| InChI | InChI=1S/C29H37N3O6S.CO2/c1-17-24(31-32-30)28(37-23-16-33-20(4)36-25(17)23)38-27-19(3)35-29(39-22-13-9-6-10-14-22)18(2)26(27)34-15-21-11-7-5-8-12-21;2-1-3/h5-14,17-20,23-29H,15-16H2,1-4H3;/t17-,18?,19?,20?,23?,24?,25+,26+,27-,28+,29+;/m1./s1 |
| InChIKey | IEEZAELRVXXTQO-KPBAGPBISA-N |
| XLogP | 5.35 |
| TPSA | 138.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|