C28H35NO8S — CID 10578479
ethyl 1-[(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]piperidine-4-carboxylate (PubChem CID 10578479) has the molecular formula C28H35NO8S and a molecular weight of 545.65 g/mol. Its IUPAC name is ethyl 1-[(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 10578479 |
| Molecular Formula | C28H35NO8S |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | ethyl 1-[(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN([C@H]2[C@@H](OC)O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@@H]2S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H35NO8S/c1-3-34-26(30)19-14-16-29(17-15-19)23-25(38(31,32)21-12-8-5-9-13-21)24-22(36-28(23)33-2)18-35-27(37-24)20-10-6-4-7-11-20/h4-13,19,22-25,27-28H,3,14-18H2,1-2H3/t22-,23-,24-,25-,27-,28+/m1/s1 |
| InChIKey | DQRBFSMXYGNWEF-UZWNBTEPSA-N |
| XLogP | 2.96 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |