C28H37NO6S — CID 11540850
1-[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]piperidine (PubChem CID 11540850) has the molecular formula C28H37NO6S and a molecular weight of 515.67 g/mol. Its IUPAC name is 1-[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]piperidine.
| Compound Name | 1-[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]piperidine |
|---|---|
| PubChem CID | 11540850 |
| Molecular Formula | C28H37NO6S |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 1-[1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]piperidine |
| SMILES | Cc1ccc(S(=O)(=O)CC([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C28H37NO6S/c1-20-12-14-22(15-13-20)36(30,31)19-23(29-16-8-5-9-17-29)24-25(32-18-21-10-6-4-7-11-21)26-27(33-24)35-28(2,3)34-26/h4,6-7,10-15,23-27H,5,8-9,16-19H2,1-3H3/t23?,24-,25+,26-,27-/m1/s1 |
| InChIKey | GVYCECBVPHVKDK-BBGUVUNVSA-N |
| XLogP | 4.09 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |