C25H31NO6S — CID 10766870
1-[(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]piperidine (PubChem CID 10766870) has the molecular formula C25H31NO6S and a molecular weight of 473.59 g/mol. Its IUPAC name is 1-[(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]piperidine.
| Compound Name | 1-[(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]piperidine |
|---|---|
| PubChem CID | 10766870 |
| Molecular Formula | C25H31NO6S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 1-[(2R,4aR,6S,7S,8R,8aR)-8-(benzenesulfonyl)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]piperidine |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](S(=O)(=O)c2ccccc2)[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C25H31NO6S/c1-29-25-21(26-15-9-4-10-16-26)23(33(27,28)19-13-7-3-8-14-19)22-20(31-25)17-30-24(32-22)18-11-5-2-6-12-18/h2-3,5-8,11-14,20-25H,4,9-10,15-17H2,1H3/t20-,21-,22-,23-,24-,25+/m1/s1 |
| InChIKey | KDNRKEHCEONARC-CRNSPECLSA-N |
| XLogP | 3.17 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |