C44H66N2O12S2 — CID 139089506
1-[(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]piperidine (PubChem CID 139089506) has the molecular formula C44H66N2O12S2 and a molecular weight of 879.15 g/mol. Its IUPAC name is 1-[(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]piperidine.
| Compound Name | 1-[(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]piperidine |
|---|---|
| PubChem CID | 139089506 |
| Molecular Formula | C44H66N2O12S2 |
| Molecular Weight | 879.15 g/mol |
| Exact Mass | 878.41 |
| IUPAC Name | 1-[(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]piperidine |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H](CS(=O)(=O)c1ccc(C)cc1)N1CCCCC1.CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H](CS(=O)(=O)c1ccc(C)cc1)N1CCCCC1 |
| InChI | InChI=1S/2C22H33NO6S/c2*1-15-8-10-16(11-9-15)30(24,25)14-17(23-12-6-5-7-13-23)18-19(26-4)20-21(27-18)29-22(2,3)28-20/h2*8-11,17-21H,5-7,12-14H2,1-4H3/t2*17-,18+,19-,20+,21+/m00/s1 |
| InChIKey | WMCGLSNMGGGRTD-AYJPQZDVSA-N |
| XLogP | 5.03 |
| TPSA | 148.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.15 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |