C18H31N7O — CID 109405119
2-[4-[[N-[[6-(dimethylamino)-2-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-methylacetamide (PubChem CID 109405119) has the molecular formula C18H31N7O and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[4-[[N-[[6-(dimethylamino)-2-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[[N-[[6-(dimethylamino)-2-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 109405119 |
| Molecular Formula | C18H31N7O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 2-[4-[[N-[[6-(dimethylamino)-2-pyridinyl]methyl]-N'-methylcarbamimidoyl]amino]piperidin-1-yl]-N-methylacetamide |
| SMILES | C/N=C(\NCc1cccc(N(C)C)n1)NC1CCN(CC(=O)NC)CC1 |
| InChI | InChI=1S/C18H31N7O/c1-19-17(26)13-25-10-8-14(9-11-25)23-18(20-2)21-12-15-6-5-7-16(22-15)24(3)4/h5-7,14H,8-13H2,1-4H3,(H,19,26)(H2,20,21,23) |
| InChIKey | NHLHGZXDMIYYOO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|