C17H26N8 — CID 75514090
1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine (PubChem CID 75514090) has the molecular formula C17H26N8 and a molecular weight of 342.45 g/mol. Its IUPAC name is 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine.
| Compound Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine |
|---|---|
| PubChem CID | 75514090 |
| Molecular Formula | C17H26N8 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)guanidine |
| SMILES | C/N=C(\NCc1cccc(N(C)C)n1)NC1CCCn2nc(C)nc21 |
| InChI | InChI=1S/C17H26N8/c1-12-20-16-14(8-6-10-25(16)23-12)22-17(18-2)19-11-13-7-5-9-15(21-13)24(3)4/h5,7,9,14H,6,8,10-11H2,1-4H3,(H2,18,19,22) |
| InChIKey | WBVIBURCVHQWCL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|