C26H32N4O3 — CID 109409031
1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 109409031) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 109409031 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCCOc2ccccc2)nc1)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C26H32N4O3/c1-2-27-26(30-19-23(20-31)22-9-5-3-6-10-22)29-18-21-13-14-25(28-17-21)33-16-15-32-24-11-7-4-8-12-24/h3-14,17,23,31H,2,15-16,18-20H2,1H3,(H2,27,29,30) |
| InChIKey | AWTUJLPVGQZILG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|