C25H38N4O3 — CID 109410689
1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[3-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]guanidine (PubChem CID 109410689) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[3-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[3-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109410689 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 1-ethyl-3-(3-hydroxy-2-phenylpropyl)-2-[[3-[2-[2-methoxyethyl(methyl)amino]ethoxy]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OCCN(C)CCOC)c1)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C25H38N4O3/c1-4-26-25(28-19-23(20-30)22-10-6-5-7-11-22)27-18-21-9-8-12-24(17-21)32-16-14-29(2)13-15-31-3/h5-12,17,23,30H,4,13-16,18-20H2,1-3H3,(H2,26,27,28) |
| InChIKey | RYLFVLMGRUYGLV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|