C29H37Cl2NO9 — CID 10941106
(Z)-3-chloro-4-[3-[(1R,2S)-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propoxy]-4-oxobut-2-enoic acid chloride (PubChem CID 10941106) has the molecular formula C29H37Cl2NO9 and a molecular weight of 614.52 g/mol. Its IUPAC name is (Z)-3-chloro-4-[3-[(1R,2S)-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propoxy]-4-oxobut-2-enoic acid chloride.
| Compound Name | (Z)-3-chloro-4-[3-[(1R,2S)-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propoxy]-4-oxobut-2-enoic acid chloride |
|---|---|
| PubChem CID | 10941106 |
| Molecular Formula | C29H37Cl2NO9 |
| Molecular Weight | 614.52 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | (Z)-3-chloro-4-[3-[(1R,2S)-6,7-dimethoxy-2-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propoxy]-4-oxobut-2-enoic acid chloride |
| SMILES | COc1cc2c(cc1OC)[C@@H](Cc1cc(OC)c(OC)c(OC)c1)[N@+](C)(CCCOC(=O)/C(Cl)=C/C(=O)O)CC2.[Cl-] |
| InChI | InChI=1S/C29H36ClNO9.ClH/c1-31(9-7-11-40-29(34)21(30)17-27(32)33)10-8-19-15-23(35-2)24(36-3)16-20(19)22(31)12-18-13-25(37-4)28(39-6)26(14-18)38-5;/h13-17,22H,7-12H2,1-6H3;1H/b21-17-;/t22-,31-;/m1./s1 |
| InChIKey | VPZDEXRRCKZZNV-WCFIZLGKSA-N |
| XLogP | 1.16 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|