C16H15NO3S — CID 1094117
N-(1,3-benzodioxol-5-yl)-2-ethylsulfanylbenzamide (PubChem CID 1094117) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-ethylsulfanylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-ethylsulfanylbenzamide |
|---|---|
| PubChem CID | 1094117 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-ethylsulfanylbenzamide |
| SMILES | CCSc1ccccc1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15NO3S/c1-2-21-15-6-4-3-5-12(15)16(18)17-11-7-8-13-14(9-11)20-10-19-13/h3-9H,2,10H2,1H3,(H,17,18) |
| InChIKey | PBOJRDFRXREWGB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |