C14H11NO3 — CID 823562
N-(1,3-benzodioxol-5-yl)benzamide (PubChem CID 823562) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)benzamide |
|---|---|
| PubChem CID | 823562 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C14H11NO3/c16-14(10-4-2-1-3-5-10)15-11-6-7-12-13(8-11)18-9-17-12/h1-8H,9H2,(H,15,16) |
| InChIKey | CYJTVYOFIOTBFR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |