About P-Tolu-M-anisidide
P-Tolu-M-anisidide (PubChem CID 3977580) has the molecular formula C15H15NO2
and a molecular weight of 241.28 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-4-methylbenzamide.
Molecular Properties
| Compound Name | P-Tolu-M-anisidide |
| PubChem CID | 3977580 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(3-methoxyphenyl)-4-methylbenzamide |
| SMILES | CC1=CC=C(C=C1)C(=O)NC2=CC(=CC=C2)OC |
| InChI | InChI=1S/C15H15NO2/c1-11-6-8-12(9-7-11)15(17)16-13-4-3-5-14(10-13)18-2/h3-10H,1-2H3,(H,16,17) |
| InChIKey | LHGUCPJOIROFJT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 272 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze P-Tolu-M-anisidide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of P-Tolu-M-anisidide?
The IUPAC name of P-Tolu-M-anisidide (CID 3977580) is N-(3-methoxyphenyl)-4-methylbenzamide.
What is the SMILES notation for P-Tolu-M-anisidide?
The canonical SMILES for P-Tolu-M-anisidide is CC1=CC=C(C=C1)C(=O)NC2=CC(=CC=C2)OC.
What is the InChIKey of P-Tolu-M-anisidide?
The InChIKey is LHGUCPJOIROFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-11-6-8-12(9-7-11)15(17)16-13-4-3-5-14(10-13)18-2/h3-10H,1-2H3,(H,16,17).
What are the key properties of P-Tolu-M-anisidide?
P-Tolu-M-anisidide has a molecular weight of 241.28 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for P-Tolu-M-anisidide is sourced from PubChem (CID 3977580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).