C15H12F3NO2 — CID 846634
Benzamide, N-(3-methoxyphenyl)-2-(trifluoromethyl)- (PubChem CID 846634) has the molecular formula C15H12F3NO2 and a molecular weight of 295.26 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-(trifluoromethyl)benzamide.
| Compound Name | Benzamide, N-(3-methoxyphenyl)-2-(trifluoromethyl)- |
|---|---|
| PubChem CID | 846634 |
| Molecular Formula | C15H12F3NO2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-(3-methoxyphenyl)-2-(trifluoromethyl)benzamide |
| SMILES | COC1=CC=CC(=C1)NC(=O)C2=CC=CC=C2C(F)(F)F |
| InChI | InChI=1S/C15H12F3NO2/c1-21-11-6-4-5-10(9-11)19-14(20)12-7-2-3-8-13(12)15(16,17)18/h2-9H,1H3,(H,19,20) |
| InChIKey | GHNDCJFNRIXYPW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | 359 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |