About VU0357121
VU0357121 (PubChem CID 2296132) has the molecular formula C17H17F2NO2
and a molecular weight of 305.32 g/mol. Its IUPAC name is 4-butoxy-N-(2,4-difluorophenyl)benzamide.
Molecular Properties
| Compound Name | VU0357121 |
| PubChem CID | 2296132 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-butoxy-N-(2,4-difluorophenyl)benzamide |
| SMILES | CCCCOC1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)F)F |
| InChI | InChI=1S/C17H17F2NO2/c1-2-3-10-22-14-7-4-12(5-8-14)17(21)20-16-9-6-13(18)11-15(16)19/h4-9,11H,2-3,10H2,1H3,(H,20,21) |
| InChIKey | AHCYOTLTLQTPSU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | 346 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze VU0357121 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of VU0357121?
The IUPAC name of VU0357121 (CID 2296132) is 4-butoxy-N-(2,4-difluorophenyl)benzamide.
What is the SMILES notation for VU0357121?
The canonical SMILES for VU0357121 is CCCCOC1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)F)F.
What is the InChIKey of VU0357121?
The InChIKey is AHCYOTLTLQTPSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2NO2/c1-2-3-10-22-14-7-4-12(5-8-14)17(21)20-16-9-6-13(18)11-15(16)19/h4-9,11H,2-3,10H2,1H3,(H,20,21).
What are the key properties of VU0357121?
VU0357121 has a molecular weight of 305.32 g/mol, XLogP of 4.20, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for VU0357121 is sourced from PubChem (CID 2296132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).