About Mepronil
Mepronil (PubChem CID 41632) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-methyl-N-(3-propan-2-yloxyphenyl)benzamide.
Molecular Properties
| Compound Name | Mepronil |
| PubChem CID | 41632 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-methyl-N-(3-propan-2-yloxyphenyl)benzamide |
| SMILES | CC1=CC=CC=C1C(=O)NC2=CC(=CC=C2)OC(C)C |
| InChI | InChI=1S/C17H19NO2/c1-12(2)20-15-9-6-8-14(11-15)18-17(19)16-10-5-4-7-13(16)3/h4-12H,1-3H3,(H,18,19) |
| InChIKey | BCTQJXQXJVLSIG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 38.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 316 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Mepronil with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Mepronil?
The IUPAC name of Mepronil (CID 41632) is 2-methyl-N-(3-propan-2-yloxyphenyl)benzamide.
What is the SMILES notation for Mepronil?
The canonical SMILES for Mepronil is CC1=CC=CC=C1C(=O)NC2=CC(=CC=C2)OC(C)C.
What is the InChIKey of Mepronil?
The InChIKey is BCTQJXQXJVLSIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-12(2)20-15-9-6-8-14(11-15)18-17(19)16-10-5-4-7-13(16)3/h4-12H,1-3H3,(H,18,19).
What are the key properties of Mepronil?
Mepronil has a molecular weight of 269.34 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Mepronil is sourced from PubChem (CID 41632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).