C21H18FN3O6 — CID 24883488
N-(3-(2-fluoroethoxy)phenyl)-N'-(1,3,4-trioxo-1,2,3,4-tetrahydroisoquinolin-6-yl)butanediamide (PubChem CID 24883488) has the molecular formula C21H18FN3O6 and a molecular weight of 427.40 g/mol. Its IUPAC name is N-[3-(2-fluoroethoxy)phenyl]-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide.
| Compound Name | N-(3-(2-fluoroethoxy)phenyl)-N'-(1,3,4-trioxo-1,2,3,4-tetrahydroisoquinolin-6-yl)butanediamide |
|---|---|
| PubChem CID | 24883488 |
| Molecular Formula | C21H18FN3O6 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[3-(2-fluoroethoxy)phenyl]-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide |
| SMILES | C1=CC(=CC(=C1)OCCF)NC(=O)CCC(=O)NC2=CC3=C(C=C2)C(=O)NC(=O)C3=O |
| InChI | InChI=1S/C21H18FN3O6/c22-8-9-31-14-3-1-2-12(10-14)23-17(26)6-7-18(27)24-13-4-5-15-16(11-13)19(28)21(30)25-20(15)29/h1-5,10-11H,6-9H2,(H,23,26)(H,24,27)(H,25,29,30) |
| InChIKey | DQXBKUVWJSZHSI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | 730 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|