C15H12N2O4 — CID 803518
N-(2-carbamoylphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 803518) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 803518 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(2-carbamoylphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12N2O4/c16-14(18)10-3-1-2-4-11(10)17-15(19)9-5-6-12-13(7-9)21-8-20-12/h1-7H,8H2,(H2,16,18)(H,17,19) |
| InChIKey | ZSIZQLUODWGPIY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |