C19H20N2O4 — CID 847830
N-[2-(tert-butylcarbamoyl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 847830) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[2-(tert-butylcarbamoyl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(tert-butylcarbamoyl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 847830 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[2-(tert-butylcarbamoyl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N2O4/c1-19(2,3)21-18(23)13-6-4-5-7-14(13)20-17(22)12-8-9-15-16(10-12)25-11-24-15/h4-10H,11H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | ATHBDOZHZDNXDX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |