C18H19NO5 — CID 109415740
1-[4-[2-(3,5-dimethylphenyl)-2-hydroxyethoxy]-3-nitrophenyl]ethanone (PubChem CID 109415740) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1-[4-[2-(3,5-dimethylphenyl)-2-hydroxyethoxy]-3-nitrophenyl]ethanone.
| Compound Name | 1-[4-[2-(3,5-dimethylphenyl)-2-hydroxyethoxy]-3-nitrophenyl]ethanone |
|---|---|
| PubChem CID | 109415740 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-[4-[2-(3,5-dimethylphenyl)-2-hydroxyethoxy]-3-nitrophenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCC(O)c2cc(C)cc(C)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19NO5/c1-11-6-12(2)8-15(7-11)17(21)10-24-18-5-4-14(13(3)20)9-16(18)19(22)23/h4-9,17,21H,10H2,1-3H3 |
| InChIKey | VVFRZAMDMLTKHD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|