C17H17F2NO3 — CID 109416261
4-[2-(2,6-difluorophenyl)-2-hydroxyethoxy]-N,N-dimethylbenzamide (PubChem CID 109416261) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is 4-[2-(2,6-difluorophenyl)-2-hydroxyethoxy]-N,N-dimethylbenzamide.
| Compound Name | 4-[2-(2,6-difluorophenyl)-2-hydroxyethoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 109416261 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-[2-(2,6-difluorophenyl)-2-hydroxyethoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(OCC(O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C17H17F2NO3/c1-20(2)17(22)11-6-8-12(9-7-11)23-10-15(21)16-13(18)4-3-5-14(16)19/h3-9,15,21H,10H2,1-2H3 |
| InChIKey | ADQOORTVKOYFIB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |