C20H33IN4O2 — CID 109418197
N-cyclohexyl-2-[[ethylamino-[(2-hydroxy-2-phenylpropyl)amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 109418197) has the molecular formula C20H33IN4O2 and a molecular weight of 488.41 g/mol. Its IUPAC name is N-cyclohexyl-2-[[ethylamino-[(2-hydroxy-2-phenylpropyl)amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclohexyl-2-[[ethylamino-[(2-hydroxy-2-phenylpropyl)amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109418197 |
| Molecular Formula | C20H33IN4O2 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N-cyclohexyl-2-[[ethylamino-[(2-hydroxy-2-phenylpropyl)amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NCC(C)(O)c1ccccc1.I |
| InChI | InChI=1S/C20H32N4O2.HI/c1-3-21-19(22-14-18(25)24-17-12-8-5-9-13-17)23-15-20(2,26)16-10-6-4-7-11-16;/h4,6-7,10-11,17,26H,3,5,8-9,12-15H2,1-2H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | ACWGNFZFNNWCMU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|