C24H31N5O2 — CID 109418532
1-ethyl-3-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-2-(2-hydroxy-2-phenylpropyl)guanidine (PubChem CID 109418532) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-2-(2-hydroxy-2-phenylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-2-(2-hydroxy-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109418532 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-ethyl-3-[2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]ethyl]-2-(2-hydroxy-2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCCc1ccc(-c2nc(CC)no2)cc1 |
| InChI | InChI=1S/C24H31N5O2/c1-4-21-28-22(31-29-21)19-13-11-18(12-14-19)15-16-26-23(25-5-2)27-17-24(3,30)20-9-7-6-8-10-20/h6-14,30H,4-5,15-17H2,1-3H3,(H2,25,26,27) |
| InChIKey | BWZLJTVFYWTYFT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|