C19H24N4OS — CID 109419950
1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-(1H-indol-2-ylmethyl)guanidine (PubChem CID 109419950) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-(1H-indol-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-(1H-indol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 109419950 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-2-ylpropyl)-2-(1H-indol-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc2ccccc2[nH]1)NCC(C)(O)c1cccs1 |
| InChI | InChI=1S/C19H24N4OS/c1-3-20-18(22-13-19(2,24)17-9-6-10-25-17)21-12-15-11-14-7-4-5-8-16(14)23-15/h4-11,23-24H,3,12-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | RYTWMJPPMRARFX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|