C15H20F3IN4 — CID 109473466
1-ethyl-2-(1H-indol-2-ylmethyl)-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109473466) has the molecular formula C15H20F3IN4 and a molecular weight of 440.25 g/mol. Its IUPAC name is 1-ethyl-2-(1H-indol-2-ylmethyl)-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(1H-indol-2-ylmethyl)-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109473466 |
| Molecular Formula | C15H20F3IN4 |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 1-ethyl-2-(1H-indol-2-ylmethyl)-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc2ccccc2[nH]1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C15H19F3N4.HI/c1-2-19-14(20-8-7-15(16,17)18)21-10-12-9-11-5-3-4-6-13(11)22-12;/h3-6,9,22H,2,7-8,10H2,1H3,(H2,19,20,21);1H |
| InChIKey | PEYBRJKZNHNJLF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|