C17H24N4 — CID 110990559
1-cyclopentyl-3-ethyl-2-(1H-indol-2-ylmethyl)guanidine (PubChem CID 110990559) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 1-cyclopentyl-3-ethyl-2-(1H-indol-2-ylmethyl)guanidine.
| Compound Name | 1-cyclopentyl-3-ethyl-2-(1H-indol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110990559 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 1-cyclopentyl-3-ethyl-2-(1H-indol-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc2ccccc2[nH]1)NC1CCCC1 |
| InChI | InChI=1S/C17H24N4/c1-2-18-17(21-14-8-4-5-9-14)19-12-15-11-13-7-3-6-10-16(13)20-15/h3,6-7,10-11,14,20H,2,4-5,8-9,12H2,1H3,(H2,18,19,21) |
| InChIKey | KNMNLJWEGJXXME-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|