C18H32N4O4S2 — CID 109420312
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine (PubChem CID 109420312) has the molecular formula C18H32N4O4S2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109420312 |
| Molecular Formula | C18H32N4O4S2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCS(=O)(=O)NCC1CCCCO1 |
| InChI | InChI=1S/C18H32N4O4S2/c1-3-19-17(21-14-18(2,23)16-8-6-11-27-16)20-9-12-28(24,25)22-13-15-7-4-5-10-26-15/h6,8,11,15,22-23H,3-5,7,9-10,12-14H2,1-2H3,(H2,19,20,21) |
| InChIKey | GHDGQHRNTITJEV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|