C21H32IN5O2S — CID 109424981
tert-butyl N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]-1-phenylethyl]carbamate;hydroiodide (PubChem CID 109424981) has the molecular formula C21H32IN5O2S and a molecular weight of 545.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]-1-phenylethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]-1-phenylethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109424981 |
| Molecular Formula | C21H32IN5O2S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | tert-butyl N-[2-[[N,N'-dimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]carbamimidoyl]amino]-1-phenylethyl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCC(NC(=O)OC(C)(C)C)c1ccccc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C21H31N5O2S.HI/c1-15-24-17(14-29-15)13-26(6)19(22-5)23-12-18(16-10-8-7-9-11-16)25-20(27)28-21(2,3)4;/h7-11,14,18H,12-13H2,1-6H3,(H,22,23)(H,25,27);1H |
| InChIKey | FMYYDMNFFIKICY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|