C23H30IN5O2S — CID 109425111
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[[2-(2-propoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 109425111) has the molecular formula C23H30IN5O2S and a molecular weight of 567.50 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[[2-(2-propoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[[2-(2-propoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109425111 |
| Molecular Formula | C23H30IN5O2S |
| Molecular Weight | 567.50 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[[2-(2-propoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCCOc1ccccc1Oc1ncccc1CN/C(=N/C)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C23H29N5O2S.HI/c1-5-13-29-20-10-6-7-11-21(20)30-22-18(9-8-12-25-22)14-26-23(24-3)28(4)15-19-16-31-17(2)27-19;/h6-12,16H,5,13-15H2,1-4H3,(H,24,26);1H |
| InChIKey | XKZRRJFFVCLRDV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|