C8H10O3 — CID 10942666
(1S,3aR,6aS)-1-methoxy-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one (PubChem CID 10942666) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (1S,3aR,6aS)-1-methoxy-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one.
| Compound Name | (1S,3aR,6aS)-1-methoxy-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one |
|---|---|
| PubChem CID | 10942666 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1S,3aR,6aS)-1-methoxy-1,3a,4,6a-tetrahydrocyclopenta[c]furan-3-one |
| SMILES | CO[C@H]1OC(=O)[C@@H]2CC=C[C@H]12 |
| InChI | InChI=1S/C8H10O3/c1-10-8-6-4-2-3-5(6)7(9)11-8/h2,4-6,8H,3H2,1H3/t5-,6+,8+/m1/s1 |
| InChIKey | XCRVBSQNFQMJHG-CHKWXVPMSA-N |
| XLogP | 0.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|