About 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one
3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one (PubChem CID 70126309) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one.
Molecular Properties
| Compound Name | 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one |
| PubChem CID | 70126309 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one |
| SMILES | CC12CC=CC1COC2=O |
| InChI | InChI=1S/C8H10O2/c1-8-4-2-3-6(8)5-10-7(8)9/h2-3,6H,4-5H2,1H3 |
| InChIKey | SXAFXJZEWZCPGS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one?
The IUPAC name of 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one (CID 70126309) is 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one.
What is the SMILES notation for 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one?
The canonical SMILES for 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one is CC12CC=CC1COC2=O.
What is the InChIKey of 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one?
The InChIKey is SXAFXJZEWZCPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-8-4-2-3-6(8)5-10-7(8)9/h2-3,6H,4-5H2,1H3.
What are the key properties of 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one?
3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one has a molecular weight of 138.17 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a-methyl-4,6a-dihydro-1H-cyclopenta[c]furan-3-one is sourced from PubChem (CID 70126309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).