C23H27IN4OS — CID 109427074
N'-methyl-4-phenoxy-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 109427074) has the molecular formula C23H27IN4OS and a molecular weight of 534.47 g/mol. Its IUPAC name is N'-methyl-4-phenoxy-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-phenoxy-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109427074 |
| Molecular Formula | C23H27IN4OS |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | N'-methyl-4-phenoxy-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1csc(-c2ccccc2)n1)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H26N4OS.HI/c1-24-23(25-16-19-17-29-22(26-19)18-8-4-2-5-9-18)27-14-12-21(13-15-27)28-20-10-6-3-7-11-20;/h2-11,17,21H,12-16H2,1H3,(H,24,25);1H |
| InChIKey | ZSJFANJKEUPVTE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|