C22H25N5OS — CID 111184794
4-(2-hydroxyphenyl)-N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111184794) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2-hydroxyphenyl)-N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111184794 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-(2-hydroxyphenyl)-N'-methyl-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1csc(-c2ccccc2)n1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C22H25N5OS/c1-23-22(24-15-18-16-29-21(25-18)17-7-3-2-4-8-17)27-13-11-26(12-14-27)19-9-5-6-10-20(19)28/h2-10,16,28H,11-15H2,1H3,(H,23,24) |
| InChIKey | XVXDLCKVVSGJLQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|