C23H35F3N4O — CID 109427207
N-ethyl-4-phenoxy-N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperidine-1-carboximidamide (PubChem CID 109427207) has the molecular formula C23H35F3N4O and a molecular weight of 440.55 g/mol. Its IUPAC name is N-ethyl-4-phenoxy-N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-phenoxy-N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427207 |
| Molecular Formula | C23H35F3N4O |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | N-ethyl-4-phenoxy-N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC1CCN(CC(F)(F)F)CC1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C23H35F3N4O/c1-2-27-22(28-13-8-19-9-14-29(15-10-19)18-23(24,25)26)30-16-11-21(12-17-30)31-20-6-4-3-5-7-20/h3-7,19,21H,2,8-18H2,1H3,(H,27,28) |
| InChIKey | HDSRXWLZILSUML-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|