C26H35FN4O — CID 109427353
N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109427353) has the molecular formula C26H35FN4O and a molecular weight of 438.59 g/mol. Its IUPAC name is N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427353 |
| Molecular Formula | C26H35FN4O |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCN(Cc2ccccc2F)CC1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C26H35FN4O/c1-28-26(31-17-13-24(14-18-31)32-23-8-3-2-4-9-23)29-19-21-11-15-30(16-12-21)20-22-7-5-6-10-25(22)27/h2-10,21,24H,11-20H2,1H3,(H,28,29) |
| InChIKey | UUBNQCUSTMINSK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|