C20H34N4O — CID 109427761
N-[3-(dimethylamino)-2,2-dimethylpropyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109427761) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427761 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-N'-methyl-4-phenoxypiperidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)(C)CN(C)C)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C20H34N4O/c1-20(2,16-23(4)5)15-22-19(21-3)24-13-11-18(12-14-24)25-17-9-7-6-8-10-17/h6-10,18H,11-16H2,1-5H3,(H,21,22) |
| InChIKey | AGAFRGWBHWJHOB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|