C22H35IN6O — CID 109428156
N'-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-N-ethyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109428156) has the molecular formula C22H35IN6O and a molecular weight of 526.47 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-N-ethyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-N-ethyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109428156 |
| Molecular Formula | C22H35IN6O |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N'-[2-(dimethylamino)-2-(1-methylpyrazol-4-yl)ethyl]-N-ethyl-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cnn(C)c1)N(C)C)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H34N6O.HI/c1-5-23-22(24-16-21(26(2)3)18-15-25-27(4)17-18)28-13-11-20(12-14-28)29-19-9-7-6-8-10-19;/h6-10,15,17,20-21H,5,11-14,16H2,1-4H3,(H,23,24);1H |
| InChIKey | QJSMBZWAPNMDGK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|