C20H29ClIN5O — CID 109428530
1-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109428530) has the molecular formula C20H29ClIN5O and a molecular weight of 517.84 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109428530 |
| Molecular Formula | C20H29ClIN5O |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)NCC(c1cccc(Cl)c1)N1CCCC1.I |
| InChI | InChI=1S/C20H28ClN5O.HI/c1-14-15(2)27-19(25-14)13-24-20(22-3)23-12-18(26-9-4-5-10-26)16-7-6-8-17(21)11-16;/h6-8,11,18H,4-5,9-10,12-13H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | WCAVWPDAOJMFJT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|