C21H28N6O — CID 109429787
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine (PubChem CID 109429787) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109429787 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3-ethyl-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nccn1CCc1ccccc1)NCc1nc(C)c(C)o1 |
| InChI | InChI=1S/C21H28N6O/c1-4-22-21(25-15-20-26-16(2)17(3)28-20)24-14-19-23-11-13-27(19)12-10-18-8-6-5-7-9-18/h5-9,11,13H,4,10,12,14-15H2,1-3H3,(H2,22,24,25) |
| InChIKey | IQDMPJKOGOGLNV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|