C25H33N5O2 — CID 109460892
1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine (PubChem CID 109460892) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109460892 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[[1-(2-phenylethyl)imidazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nccn1CCc1ccccc1)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C25H33N5O2/c1-3-26-25(29-22-11-7-12-23(19-22)32-18-8-17-31-2)28-20-24-27-14-16-30(24)15-13-21-9-5-4-6-10-21/h4-7,9-12,14,16,19H,3,8,13,15,17-18,20H2,1-2H3,(H2,26,28,29) |
| InChIKey | CFIFYCCNHHBVJY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|