C24H36N4O2 — CID 109461990
1-ethyl-2-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-3-[3-(3-methoxypropoxy)phenyl]guanidine (PubChem CID 109461990) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-ethyl-2-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-3-[3-(3-methoxypropoxy)phenyl]guanidine.
| Compound Name | 1-ethyl-2-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-3-[3-(3-methoxypropoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 109461990 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 1-ethyl-2-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-3-[3-(3-methoxypropoxy)phenyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(CN(C)CC)c1)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C24H36N4O2/c1-5-25-24(26-18-20-10-7-11-21(16-20)19-28(3)6-2)27-22-12-8-13-23(17-22)30-15-9-14-29-4/h7-8,10-13,16-17H,5-6,9,14-15,18-19H2,1-4H3,(H2,25,26,27) |
| InChIKey | PLZOSPDQJNECHM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|