C22H28N6O2 — CID 109460128
1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine (PubChem CID 109460128) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 109460128 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(-c2ncn[nH]2)c1)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C22H28N6O2/c1-3-23-22(27-19-9-5-10-20(14-19)30-12-6-11-29-2)24-15-17-7-4-8-18(13-17)21-25-16-26-28-21/h4-5,7-10,13-14,16H,3,6,11-12,15H2,1-2H3,(H2,23,24,27)(H,25,26,28) |
| InChIKey | LWHDQSQOCKFBAB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|