C22H30N4O4 — CID 109460588
methyl N-[4-[[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]methyl]phenyl]carbamate (PubChem CID 109460588) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is methyl N-[4-[[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 109460588 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | methyl N-[4-[[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]methyl]phenyl]carbamate |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)OC)cc1)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C22H30N4O4/c1-4-23-21(24-16-17-9-11-18(12-10-17)26-22(27)29-3)25-19-7-5-8-20(15-19)30-14-6-13-28-2/h5,7-12,15H,4,6,13-14,16H2,1-3H3,(H,26,27)(H2,23,24,25) |
| InChIKey | GXLUWMQINORWDR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|