C18H29N3O4 — CID 109460186
methyl 3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]-2-methylpropanoate (PubChem CID 109460186) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is methyl 3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]-2-methylpropanoate.
| Compound Name | methyl 3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 109460186 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | methyl 3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]-2-methylpropanoate |
| SMILES | CCN/C(=N\CC(C)C(=O)OC)Nc1cccc(OCCCOC)c1 |
| InChI | InChI=1S/C18H29N3O4/c1-5-19-18(20-13-14(2)17(22)24-4)21-15-8-6-9-16(12-15)25-11-7-10-23-3/h6,8-9,12,14H,5,7,10-11,13H2,1-4H3,(H2,19,20,21) |
| InChIKey | CNGMVCRUFQYJDO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|