C20H35IN4O3 — CID 109461985
N,N-diethyl-3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propanamide;hydroiodide (PubChem CID 109461985) has the molecular formula C20H35IN4O3 and a molecular weight of 506.43 g/mol. Its IUPAC name is N,N-diethyl-3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propanamide;hydroiodide.
| Compound Name | N,N-diethyl-3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109461985 |
| Molecular Formula | C20H35IN4O3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N,N-diethyl-3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(CC)CC)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C20H34N4O3.HI/c1-5-21-20(22-13-12-19(25)24(6-2)7-3)23-17-10-8-11-18(16-17)27-15-9-14-26-4;/h8,10-11,16H,5-7,9,12-15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | OFSAQODHOFVOJF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|