C20H35IN4O4 — CID 109462219
tert-butyl N-[2-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]ethyl]carbamate;hydroiodide (PubChem CID 109462219) has the molecular formula C20H35IN4O4 and a molecular weight of 522.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109462219 |
| Molecular Formula | C20H35IN4O4 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)OC(C)(C)C)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C20H34N4O4.HI/c1-6-21-18(22-11-12-23-19(25)28-20(2,3)4)24-16-9-7-10-17(15-16)27-14-8-13-26-5;/h7,9-10,15H,6,8,11-14H2,1-5H3,(H,23,25)(H2,21,22,24);1H |
| InChIKey | GNLDKQMOZJFUAW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|