C21H35IN4O3 — CID 109460119
N-[3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propyl]cyclobutanecarboxamide;hydroiodide (PubChem CID 109460119) has the molecular formula C21H35IN4O3 and a molecular weight of 518.44 g/mol. Its IUPAC name is N-[3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propyl]cyclobutanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propyl]cyclobutanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 109460119 |
| Molecular Formula | C21H35IN4O3 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propyl]cyclobutanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)C1CCC1)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C21H34N4O3.HI/c1-3-22-21(24-13-6-12-23-20(26)17-8-4-9-17)25-18-10-5-11-19(16-18)28-15-7-14-27-2;/h5,10-11,16-17H,3-4,6-9,12-15H2,1-2H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | CWUYJJSWJAIUJM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|