C23H32ClIN4O3 — CID 109461639
N-(2-chloro-4-methylphenyl)-3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propanamide;hydroiodide (PubChem CID 109461639) has the molecular formula C23H32ClIN4O3 and a molecular weight of 574.89 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propanamide;hydroiodide.
| Compound Name | N-(2-chloro-4-methylphenyl)-3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109461639 |
| Molecular Formula | C23H32ClIN4O3 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-3-[[ethylamino-[3-(3-methoxypropoxy)anilino]methylidene]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)Nc1ccc(C)cc1Cl)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C23H31ClN4O3.HI/c1-4-25-23(27-18-7-5-8-19(16-18)31-14-6-13-30-3)26-12-11-22(29)28-21-10-9-17(2)15-20(21)24;/h5,7-10,15-16H,4,6,11-14H2,1-3H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | NRLPJYGIAXCGGT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|