C22H33IN4O4S — CID 109461267
1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 109461267) has the molecular formula C22H33IN4O4S and a molecular weight of 576.50 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109461267 |
| Molecular Formula | C22H33IN4O4S |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 1-ethyl-3-[3-(3-methoxypropoxy)phenyl]-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1ccc(C)cc1)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C22H32N4O4S.HI/c1-4-23-22(26-19-7-5-8-20(17-19)30-16-6-15-29-3)24-13-14-25-31(27,28)21-11-9-18(2)10-12-21;/h5,7-12,17,25H,4,6,13-16H2,1-3H3,(H2,23,24,26);1H |
| InChIKey | MCGIZCXMALSUAT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|