C23H34IN3O4 — CID 109460247
1-ethyl-2-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-[3-(3-methoxypropoxy)phenyl]guanidine;hydroiodide (PubChem CID 109460247) has the molecular formula C23H34IN3O4 and a molecular weight of 543.45 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-[3-(3-methoxypropoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-[3-(3-methoxypropoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109460247 |
| Molecular Formula | C23H34IN3O4 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-[3-(3-methoxypropoxy)phenyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1cccc(C)c1)Nc1cccc(OCCCOC)c1.I |
| InChI | InChI=1S/C23H33N3O4.HI/c1-4-24-23(25-16-20(27)17-30-21-10-5-8-18(2)14-21)26-19-9-6-11-22(15-19)29-13-7-12-28-3;/h5-6,8-11,14-15,20,27H,4,7,12-13,16-17H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | WJWMEDCJIHQPNT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|